C19H13Cl3FNO2 — CID 18551342
2,2,2-trichloro-N-[2-[(3-fluoronaphthalen-1-yl)methoxy]phenyl]acetamide (PubChem CID 18551342) has the molecular formula C19H13Cl3FNO2 and a molecular weight of 412.68 g/mol. Its IUPAC name is 2,2,2-trichloro-N-[2-[(3-fluoronaphthalen-1-yl)methoxy]phenyl]acetamide.
| Compound Name | 2,2,2-trichloro-N-[2-[(3-fluoronaphthalen-1-yl)methoxy]phenyl]acetamide |
|---|---|
| PubChem CID | 18551342 |
| Molecular Formula | C19H13Cl3FNO2 |
| Molecular Weight | 412.68 g/mol |
| Exact Mass | 411.00 |
| IUPAC Name | 2,2,2-trichloro-N-[2-[(3-fluoronaphthalen-1-yl)methoxy]phenyl]acetamide |
| SMILES | O=C(Nc1ccccc1OCc1cc(F)cc2ccccc12)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C19H13Cl3FNO2/c20-19(21,22)18(25)24-16-7-3-4-8-17(16)26-11-13-10-14(23)9-12-5-1-2-6-15(12)13/h1-10H,11H2,(H,24,25) |
| InChIKey | KBNMAAGZSSAQFN-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.68 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|