C18H14N2O3 — CID 11779892
2-[2-(isoquinolin-8-ylamino)-2-oxoethyl]benzoic acid (PubChem CID 11779892) has the molecular formula C18H14N2O3 and a molecular weight of 306.32 g/mol. Its IUPAC name is 2-[2-(isoquinolin-8-ylamino)-2-oxoethyl]benzoic acid.
| Compound Name | 2-[2-(isoquinolin-8-ylamino)-2-oxoethyl]benzoic acid |
|---|---|
| PubChem CID | 11779892 |
| Molecular Formula | C18H14N2O3 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 2-[2-(isoquinolin-8-ylamino)-2-oxoethyl]benzoic acid |
| SMILES | O=C(Cc1ccccc1C(=O)O)Nc1cccc2ccncc12 |
| InChI | InChI=1S/C18H14N2O3/c21-17(10-13-4-1-2-6-14(13)18(22)23)20-16-7-3-5-12-8-9-19-11-15(12)16/h1-9,11H,10H2,(H,20,21)(H,22,23) |
| InChIKey | YTRIEPLRYTXTAV-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |