C24H19N3O3 — CID 176939000
N-[2-oxo-2-(2-phenoxyanilino)ethyl]isoquinoline-8-carboxamide (PubChem CID 176939000) has the molecular formula C24H19N3O3 and a molecular weight of 397.43 g/mol. Its IUPAC name is N-[2-oxo-2-(2-phenoxyanilino)ethyl]isoquinoline-8-carboxamide.
| Compound Name | N-[2-oxo-2-(2-phenoxyanilino)ethyl]isoquinoline-8-carboxamide |
|---|---|
| PubChem CID | 176939000 |
| Molecular Formula | C24H19N3O3 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | N-[2-oxo-2-(2-phenoxyanilino)ethyl]isoquinoline-8-carboxamide |
| SMILES | O=C(CNC(=O)c1cccc2ccncc12)Nc1ccccc1Oc1ccccc1 |
| InChI | InChI=1S/C24H19N3O3/c28-23(16-26-24(29)19-10-6-7-17-13-14-25-15-20(17)19)27-21-11-4-5-12-22(21)30-18-8-2-1-3-9-18/h1-15H,16H2,(H,26,29)(H,27,28) |
| InChIKey | HUQKDQUHSPUGFW-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |