C27H24N2O4 — CID 176939013
N-[2-[2-(3-methoxy-5-methylphenoxy)anilino]-2-oxoethyl]naphthalene-1-carboxamide (PubChem CID 176939013) has the molecular formula C27H24N2O4 and a molecular weight of 440.50 g/mol. Its IUPAC name is N-[2-[2-(3-methoxy-5-methylphenoxy)anilino]-2-oxoethyl]naphthalene-1-carboxamide.
| Compound Name | N-[2-[2-(3-methoxy-5-methylphenoxy)anilino]-2-oxoethyl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 176939013 |
| Molecular Formula | C27H24N2O4 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | N-[2-[2-(3-methoxy-5-methylphenoxy)anilino]-2-oxoethyl]naphthalene-1-carboxamide |
| SMILES | COc1cc(C)cc(Oc2ccccc2NC(=O)CNC(=O)c2cccc3ccccc23)c1 |
| InChI | InChI=1S/C27H24N2O4/c1-18-14-20(32-2)16-21(15-18)33-25-13-6-5-12-24(25)29-26(30)17-28-27(31)23-11-7-9-19-8-3-4-10-22(19)23/h3-16H,17H2,1-2H3,(H,28,31)(H,29,30) |
| InChIKey | CRSRZIPWPRZCBT-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |