C28H24N2O4 — CID 169183147
N-[2-[2-(3-methoxyphenoxy)anilino]-2-oxoethyl]-4-phenylbenzamide (PubChem CID 169183147) has the molecular formula C28H24N2O4 and a molecular weight of 452.51 g/mol. Its IUPAC name is N-[2-[2-(3-methoxyphenoxy)anilino]-2-oxoethyl]-4-phenylbenzamide.
| Compound Name | N-[2-[2-(3-methoxyphenoxy)anilino]-2-oxoethyl]-4-phenylbenzamide |
|---|---|
| PubChem CID | 169183147 |
| Molecular Formula | C28H24N2O4 |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | N-[2-[2-(3-methoxyphenoxy)anilino]-2-oxoethyl]-4-phenylbenzamide |
| SMILES | COc1cccc(Oc2ccccc2NC(=O)CNC(=O)c2ccc(-c3ccccc3)cc2)c1 |
| InChI | InChI=1S/C28H24N2O4/c1-33-23-10-7-11-24(18-23)34-26-13-6-5-12-25(26)30-27(31)19-29-28(32)22-16-14-21(15-17-22)20-8-3-2-4-9-20/h2-18H,19H2,1H3,(H,29,32)(H,30,31) |
| InChIKey | MMTLZCDQVHFJLG-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |