C28H28N2O5 — CID 176939001
N-[2-(3,5-dimethoxyphenoxy)phenyl]formamide;N-ethylnaphthalene-1-carboxamide (PubChem CID 176939001) has the molecular formula C28H28N2O5 and a molecular weight of 472.54 g/mol. Its IUPAC name is N-[2-(3,5-dimethoxyphenoxy)phenyl]formamide;N-ethylnaphthalene-1-carboxamide.
| Compound Name | N-[2-(3,5-dimethoxyphenoxy)phenyl]formamide;N-ethylnaphthalene-1-carboxamide |
|---|---|
| PubChem CID | 176939001 |
| Molecular Formula | C28H28N2O5 |
| Molecular Weight | 472.54 g/mol |
| Exact Mass | 472.20 |
| IUPAC Name | N-[2-(3,5-dimethoxyphenoxy)phenyl]formamide;N-ethylnaphthalene-1-carboxamide |
| SMILES | CCNC(=O)c1cccc2ccccc12.COc1cc(OC)cc(Oc2ccccc2NC=O)c1 |
| InChI | InChI=1S/C15H15NO4.C13H13NO/c1-18-11-7-12(19-2)9-13(8-11)20-15-6-4-3-5-14(15)16-10-17;1-2-14-13(15)12-9-5-7-10-6-3-4-8-11(10)12/h3-10H,1-2H3,(H,16,17);3-9H,2H2,1H3,(H,14,15) |
| InChIKey | IHBYQFXNPPYXNY-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.54 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|