C26H24N2O3 — CID 176939045
N-methyl-2-phenoxyaniline;N-(2-oxoethyl)naphthalene-1-carboxamide (PubChem CID 176939045) has the molecular formula C26H24N2O3 and a molecular weight of 412.49 g/mol. Its IUPAC name is N-methyl-2-phenoxyaniline;N-(2-oxoethyl)naphthalene-1-carboxamide.
| Compound Name | N-methyl-2-phenoxyaniline;N-(2-oxoethyl)naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 176939045 |
| Molecular Formula | C26H24N2O3 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | N-methyl-2-phenoxyaniline;N-(2-oxoethyl)naphthalene-1-carboxamide |
| SMILES | CNc1ccccc1Oc1ccccc1.O=CCNC(=O)c1cccc2ccccc12 |
| InChI | InChI=1S/C13H11NO2.C13H13NO/c15-9-8-14-13(16)12-7-3-5-10-4-1-2-6-11(10)12;1-14-12-9-5-6-10-13(12)15-11-7-3-2-4-8-11/h1-7,9H,8H2,(H,14,16);2-10,14H,1H3 |
| InChIKey | NWQGHFYBVLKOGD-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|