C24H30N2O3 — CID 169183134
ethane;(2E)-2-ethenyl-N-(2-oxoethyl)penta-2,4-dienamide;N-methyl-2-phenoxyaniline (PubChem CID 169183134) has the molecular formula C24H30N2O3 and a molecular weight of 394.52 g/mol. Its IUPAC name is ethane;(2E)-2-ethenyl-N-(2-oxoethyl)penta-2,4-dienamide;N-methyl-2-phenoxyaniline.
| Compound Name | ethane;(2E)-2-ethenyl-N-(2-oxoethyl)penta-2,4-dienamide;N-methyl-2-phenoxyaniline |
|---|---|
| PubChem CID | 169183134 |
| Molecular Formula | C24H30N2O3 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.23 |
| IUPAC Name | ethane;(2E)-2-ethenyl-N-(2-oxoethyl)penta-2,4-dienamide;N-methyl-2-phenoxyaniline |
| SMILES | C=C/C=C(\C=C)C(=O)NCC=O.CC.CNc1ccccc1Oc1ccccc1 |
| InChI | InChI=1S/C13H13NO.C9H11NO2.C2H6/c1-14-12-9-5-6-10-13(12)15-11-7-3-2-4-8-11;1-3-5-8(4-2)9(12)10-6-7-11;1-2/h2-10,14H,1H3;3-5,7H,1-2,6H2,(H,10,12);1-2H3/b;8-5+; |
| InChIKey | SBZUSPXPGOEJAW-UKXMSUEASA-N |
| XLogP | 5.15 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|