C15H14N2O4 — CID 102945466
(2R,5S)-5-(isoquinolin-8-ylcarbamoyl)oxolane-2-carboxylic acid (PubChem CID 102945466) has the molecular formula C15H14N2O4 and a molecular weight of 286.29 g/mol. Its IUPAC name is (2R,5S)-5-(isoquinolin-8-ylcarbamoyl)oxolane-2-carboxylic acid.
| Compound Name | (2R,5S)-5-(isoquinolin-8-ylcarbamoyl)oxolane-2-carboxylic acid |
|---|---|
| PubChem CID | 102945466 |
| Molecular Formula | C15H14N2O4 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | (2R,5S)-5-(isoquinolin-8-ylcarbamoyl)oxolane-2-carboxylic acid |
| SMILES | O=C(Nc1cccc2ccncc12)[C@@H]1CC[C@H](C(=O)O)O1 |
| InChI | InChI=1S/C15H14N2O4/c18-14(12-4-5-13(21-12)15(19)20)17-11-3-1-2-9-6-7-16-8-10(9)11/h1-3,6-8,12-13H,4-5H2,(H,17,18)(H,19,20)/t12-,13+/m0/s1 |
| InChIKey | VJZLLSVGZBGQQW-QWHCGFSZSA-N |
| XLogP | 1.81 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |