C25H27N3O3 — CID 56949895
4-[(1R,2R,6S,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]-N-isoquinolin-8-ylcyclohexane-1-carboxamide (PubChem CID 56949895) has the molecular formula C25H27N3O3 and a molecular weight of 417.51 g/mol. Its IUPAC name is 4-[(1R,2R,6S,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]-N-isoquinolin-8-ylcyclohexane-1-carboxamide.
| Compound Name | 4-[(1R,2R,6S,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]-N-isoquinolin-8-ylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 56949895 |
| Molecular Formula | C25H27N3O3 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | 4-[(1R,2R,6S,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]-N-isoquinolin-8-ylcyclohexane-1-carboxamide |
| SMILES | O=C(Nc1cccc2ccncc12)C1CCC(N2C(=O)[C@@H]3[C@@H]4CC[C@@H](C4)[C@@H]3C2=O)CC1 |
| InChI | InChI=1S/C25H27N3O3/c29-23(27-20-3-1-2-14-10-11-26-13-19(14)20)15-6-8-18(9-7-15)28-24(30)21-16-4-5-17(12-16)22(21)25(28)31/h1-3,10-11,13,15-18,21-22H,4-9,12H2,(H,27,29)/t15?,16-,17+,18?,21-,22+ |
| InChIKey | YPCRGPXNTYVGQS-PLUMSZRTSA-N |
| XLogP | 3.76 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|