C22H25ClN2O4 — CID 2951116
N-(4-chloro-2-hydroxyphenyl)-4-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)cyclohexane-1-carboxamide (PubChem CID 2951116) has the molecular formula C22H25ClN2O4 and a molecular weight of 416.91 g/mol. Its IUPAC name is N-(4-chloro-2-hydroxyphenyl)-4-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)cyclohexane-1-carboxamide.
| Compound Name | N-(4-chloro-2-hydroxyphenyl)-4-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 2951116 |
| Molecular Formula | C22H25ClN2O4 |
| Molecular Weight | 416.91 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | N-(4-chloro-2-hydroxyphenyl)-4-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)cyclohexane-1-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1O)C1CCC(N2C(=O)C3C4CCC(C4)C3C2=O)CC1 |
| InChI | InChI=1S/C22H25ClN2O4/c23-14-5-8-16(17(26)10-14)24-20(27)11-3-6-15(7-4-11)25-21(28)18-12-1-2-13(9-12)19(18)22(25)29/h5,8,10-13,15,18-19,26H,1-4,6-7,9H2,(H,24,27) |
| InChIKey | MIKMYFBIXGOICR-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.91 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|