About (naphthalen-1-ylamino) carbamate
(naphthalen-1-ylamino) carbamate (PubChem CID 57425997) has the molecular formula C11H10N2O2
and a molecular weight of 202.21 g/mol. Its IUPAC name is (naphthalen-1-ylamino) carbamate.
Molecular Properties
| Compound Name | (naphthalen-1-ylamino) carbamate |
| PubChem CID | 57425997 |
| Molecular Formula | C11H10N2O2 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.07 |
| IUPAC Name | (naphthalen-1-ylamino) carbamate |
| SMILES | NC(=O)ONc1cccc2ccccc12 |
| InChI | InChI=1S/C11H10N2O2/c12-11(14)15-13-10-7-3-5-8-4-1-2-6-9(8)10/h1-7,13H,(H2,12,14) |
| InChIKey | GBZOMJXHNSPDNX-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (naphthalen-1-ylamino) carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (naphthalen-1-ylamino) carbamate?
The IUPAC name of (naphthalen-1-ylamino) carbamate (CID 57425997) is (naphthalen-1-ylamino) carbamate.
What is the SMILES notation for (naphthalen-1-ylamino) carbamate?
The canonical SMILES for (naphthalen-1-ylamino) carbamate is NC(=O)ONc1cccc2ccccc12.
What is the InChIKey of (naphthalen-1-ylamino) carbamate?
The InChIKey is GBZOMJXHNSPDNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N2O2/c12-11(14)15-13-10-7-3-5-8-4-1-2-6-9(8)10/h1-7,13H,(H2,12,14).
What are the key properties of (naphthalen-1-ylamino) carbamate?
(naphthalen-1-ylamino) carbamate has a molecular weight of 202.21 g/mol, XLogP of 2.26, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (naphthalen-1-ylamino) carbamate is sourced from PubChem (CID 57425997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).