C26H22N4O4 — CID 43835675
[(E)-[(3E)-3-(naphthalen-1-ylcarbamoyloxyimino)butan-2-ylidene]amino] N-naphthalen-1-ylcarbamate (PubChem CID 43835675) has the molecular formula C26H22N4O4 and a molecular weight of 454.49 g/mol. Its IUPAC name is [(E)-[(3E)-3-(naphthalen-1-ylcarbamoyloxyimino)butan-2-ylidene]amino] N-naphthalen-1-ylcarbamate.
| Compound Name | [(E)-[(3E)-3-(naphthalen-1-ylcarbamoyloxyimino)butan-2-ylidene]amino] N-naphthalen-1-ylcarbamate |
|---|---|
| PubChem CID | 43835675 |
| Molecular Formula | C26H22N4O4 |
| Molecular Weight | 454.49 g/mol |
| Exact Mass | 454.16 |
| IUPAC Name | [(E)-[(3E)-3-(naphthalen-1-ylcarbamoyloxyimino)butan-2-ylidene]amino] N-naphthalen-1-ylcarbamate |
| SMILES | CC(=N\OC(=O)Nc1cccc2ccccc12)/C(C)=N/OC(=O)Nc1cccc2ccccc12 |
| InChI | InChI=1S/C26H22N4O4/c1-17(29-33-25(31)27-23-15-7-11-19-9-3-5-13-21(19)23)18(2)30-34-26(32)28-24-16-8-12-20-10-4-6-14-22(20)24/h3-16H,1-2H3,(H,27,31)(H,28,32)/b29-17+,30-18+ |
| InChIKey | VPKIFAFJFJBDJO-YAGSLNJISA-N |
| XLogP | 6.54 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.49 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|