About (2-carbamoylphenyl) N-naphthalen-1-ylcarbamate
(2-carbamoylphenyl) N-naphthalen-1-ylcarbamate (PubChem CID 4121359) has the molecular formula C18H14N2O3
and a molecular weight of 306.32 g/mol. Its IUPAC name is (2-carbamoylphenyl) N-naphthalen-1-ylcarbamate.
Molecular Properties
| Compound Name | (2-carbamoylphenyl) N-naphthalen-1-ylcarbamate |
| PubChem CID | 4121359 |
| Molecular Formula | C18H14N2O3 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | (2-carbamoylphenyl) N-naphthalen-1-ylcarbamate |
| SMILES | NC(=O)c1ccccc1OC(=O)Nc1cccc2ccccc12 |
| InChI | InChI=1S/C18H14N2O3/c19-17(21)14-9-3-4-11-16(14)23-18(22)20-15-10-5-7-12-6-1-2-8-13(12)15/h1-11H,(H2,19,21)(H,20,22) |
| InChIKey | MEXJPADWZOGFPW-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2-carbamoylphenyl) N-naphthalen-1-ylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-carbamoylphenyl) N-naphthalen-1-ylcarbamate?
The IUPAC name of (2-carbamoylphenyl) N-naphthalen-1-ylcarbamate (CID 4121359) is (2-carbamoylphenyl) N-naphthalen-1-ylcarbamate.
What is the SMILES notation for (2-carbamoylphenyl) N-naphthalen-1-ylcarbamate?
The canonical SMILES for (2-carbamoylphenyl) N-naphthalen-1-ylcarbamate is NC(=O)c1ccccc1OC(=O)Nc1cccc2ccccc12.
What is the InChIKey of (2-carbamoylphenyl) N-naphthalen-1-ylcarbamate?
The InChIKey is MEXJPADWZOGFPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14N2O3/c19-17(21)14-9-3-4-11-16(14)23-18(22)20-15-10-5-7-12-6-1-2-8-13(12)15/h1-11H,(H2,19,21)(H,20,22).
What are the key properties of (2-carbamoylphenyl) N-naphthalen-1-ylcarbamate?
(2-carbamoylphenyl) N-naphthalen-1-ylcarbamate has a molecular weight of 306.32 g/mol, XLogP of 3.55, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-carbamoylphenyl) N-naphthalen-1-ylcarbamate is sourced from PubChem (CID 4121359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).