C19H13F2NO6S — CID 177295076
1,1-difluoro-2-[2-(naphthalen-1-ylcarbamoyl)phenoxy]-2-oxoethanesulfonic acid (PubChem CID 177295076) has the molecular formula C19H13F2NO6S and a molecular weight of 421.38 g/mol. Its IUPAC name is 1,1-difluoro-2-[2-(naphthalen-1-ylcarbamoyl)phenoxy]-2-oxoethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-[2-(naphthalen-1-ylcarbamoyl)phenoxy]-2-oxoethanesulfonic acid |
|---|---|
| PubChem CID | 177295076 |
| Molecular Formula | C19H13F2NO6S |
| Molecular Weight | 421.38 g/mol |
| Exact Mass | 421.04 |
| IUPAC Name | 1,1-difluoro-2-[2-(naphthalen-1-ylcarbamoyl)phenoxy]-2-oxoethanesulfonic acid |
| SMILES | O=C(Nc1cccc2ccccc12)c1ccccc1OC(=O)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C19H13F2NO6S/c20-19(21,29(25,26)27)18(24)28-16-11-4-3-9-14(16)17(23)22-15-10-5-7-12-6-1-2-8-13(12)15/h1-11H,(H,22,23)(H,25,26,27) |
| InChIKey | PJOOWRRXSLXLHS-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.38 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|