C17H11F2NO — CID 2981920
2,4-difluoro-N-naphthalen-1-ylbenzamide (PubChem CID 2981920) has the molecular formula C17H11F2NO and a molecular weight of 283.28 g/mol. Its IUPAC name is 2,4-difluoro-N-naphthalen-1-ylbenzamide.
| Compound Name | 2,4-difluoro-N-naphthalen-1-ylbenzamide |
|---|---|
| PubChem CID | 2981920 |
| Molecular Formula | C17H11F2NO |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | 2,4-difluoro-N-naphthalen-1-ylbenzamide |
| SMILES | O=C(Nc1cccc2ccccc12)c1ccc(F)cc1F |
| InChI | InChI=1S/C17H11F2NO/c18-12-8-9-14(15(19)10-12)17(21)20-16-7-3-5-11-4-1-2-6-13(11)16/h1-10H,(H,20,21) |
| InChIKey | HKIPQSKHXNESPB-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |