C14H7F3N2O — CID 43580325
N-(2-cyano-3-fluorophenyl)-2,4-difluorobenzamide (PubChem CID 43580325) has the molecular formula C14H7F3N2O and a molecular weight of 276.22 g/mol. Its IUPAC name is N-(2-cyano-3-fluorophenyl)-2,4-difluorobenzamide.
| Compound Name | N-(2-cyano-3-fluorophenyl)-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 43580325 |
| Molecular Formula | C14H7F3N2O |
| Molecular Weight | 276.22 g/mol |
| Exact Mass | 276.05 |
| IUPAC Name | N-(2-cyano-3-fluorophenyl)-2,4-difluorobenzamide |
| SMILES | N#Cc1c(F)cccc1NC(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C14H7F3N2O/c15-8-4-5-9(12(17)6-8)14(20)19-13-3-1-2-11(16)10(13)7-18/h1-6H,(H,19,20) |
| InChIKey | FKNXGAUBKUKYOS-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.22 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |