C19H13F2NO3 — CID 2555012
[2-(naphthalen-1-ylamino)-2-oxoethyl] 2,4-difluorobenzoate (PubChem CID 2555012) has the molecular formula C19H13F2NO3 and a molecular weight of 341.31 g/mol. Its IUPAC name is [2-(naphthalen-1-ylamino)-2-oxoethyl] 2,4-difluorobenzoate.
| Compound Name | [2-(naphthalen-1-ylamino)-2-oxoethyl] 2,4-difluorobenzoate |
|---|---|
| PubChem CID | 2555012 |
| Molecular Formula | C19H13F2NO3 |
| Molecular Weight | 341.31 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | [2-(naphthalen-1-ylamino)-2-oxoethyl] 2,4-difluorobenzoate |
| SMILES | O=C(COC(=O)c1ccc(F)cc1F)Nc1cccc2ccccc12 |
| InChI | InChI=1S/C19H13F2NO3/c20-13-8-9-15(16(21)10-13)19(24)25-11-18(23)22-17-7-3-5-12-4-1-2-6-14(12)17/h1-10H,11H2,(H,22,23) |
| InChIKey | WVXVXWJQTVVSRC-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.31 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |