C19H14INO4 — CID 23940957
[2-(naphthalen-1-ylamino)-2-oxoethyl] 2-hydroxy-5-iodobenzoate (PubChem CID 23940957) has the molecular formula C19H14INO4 and a molecular weight of 447.23 g/mol. Its IUPAC name is [2-(naphthalen-1-ylamino)-2-oxoethyl] 2-hydroxy-5-iodobenzoate.
| Compound Name | [2-(naphthalen-1-ylamino)-2-oxoethyl] 2-hydroxy-5-iodobenzoate |
|---|---|
| PubChem CID | 23940957 |
| Molecular Formula | C19H14INO4 |
| Molecular Weight | 447.23 g/mol |
| Exact Mass | 447.00 |
| IUPAC Name | [2-(naphthalen-1-ylamino)-2-oxoethyl] 2-hydroxy-5-iodobenzoate |
| SMILES | O=C(COC(=O)c1cc(I)ccc1O)Nc1cccc2ccccc12 |
| InChI | InChI=1S/C19H14INO4/c20-13-8-9-17(22)15(10-13)19(24)25-11-18(23)21-16-7-3-5-12-4-1-2-6-14(12)16/h1-10,22H,11H2,(H,21,23) |
| InChIKey | ZZOSXEUWRZAVLD-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.23 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|