C23H18F4N2O4 — CID 153463845
[5-[(Z)-2-(aminomethyl)-3-fluoroprop-2-enoxy]-2-(naphthalen-1-ylcarbamoyl)phenyl] 2,2,2-trifluoroacetate (PubChem CID 153463845) has the molecular formula C23H18F4N2O4 and a molecular weight of 462.40 g/mol. Its IUPAC name is [5-[(Z)-2-(aminomethyl)-3-fluoroprop-2-enoxy]-2-(naphthalen-1-ylcarbamoyl)phenyl] 2,2,2-trifluoroacetate.
| Compound Name | [5-[(Z)-2-(aminomethyl)-3-fluoroprop-2-enoxy]-2-(naphthalen-1-ylcarbamoyl)phenyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 153463845 |
| Molecular Formula | C23H18F4N2O4 |
| Molecular Weight | 462.40 g/mol |
| Exact Mass | 462.12 |
| IUPAC Name | [5-[(Z)-2-(aminomethyl)-3-fluoroprop-2-enoxy]-2-(naphthalen-1-ylcarbamoyl)phenyl] 2,2,2-trifluoroacetate |
| SMILES | NC/C(=C/F)COc1ccc(C(=O)Nc2cccc3ccccc23)c(OC(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C23H18F4N2O4/c24-11-14(12-28)13-32-16-8-9-18(20(10-16)33-22(31)23(25,26)27)21(30)29-19-7-3-5-15-4-1-2-6-17(15)19/h1-11H,12-13,28H2,(H,29,30)/b14-11- |
| InChIKey | GHXPJNABGYIAQU-KAMYIIQDSA-N |
| XLogP | 4.75 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.40 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|