C20H19FN4O2 — CID 146477341
4-[(Z)-2-(aminomethyl)-3-fluoroprop-2-enoxy]-2-methyl-N-quinazolin-7-ylbenzamide (PubChem CID 146477341) has the molecular formula C20H19FN4O2 and a molecular weight of 366.40 g/mol. Its IUPAC name is 4-[(Z)-2-(aminomethyl)-3-fluoroprop-2-enoxy]-2-methyl-N-quinazolin-7-ylbenzamide.
| Compound Name | 4-[(Z)-2-(aminomethyl)-3-fluoroprop-2-enoxy]-2-methyl-N-quinazolin-7-ylbenzamide |
|---|---|
| PubChem CID | 146477341 |
| Molecular Formula | C20H19FN4O2 |
| Molecular Weight | 366.40 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | 4-[(Z)-2-(aminomethyl)-3-fluoroprop-2-enoxy]-2-methyl-N-quinazolin-7-ylbenzamide |
| SMILES | Cc1cc(OC/C(=C\F)CN)ccc1C(=O)Nc1ccc2cncnc2c1 |
| InChI | InChI=1S/C20H19FN4O2/c1-13-6-17(27-11-14(8-21)9-22)4-5-18(13)20(26)25-16-3-2-15-10-23-12-24-19(15)7-16/h2-8,10,12H,9,11,22H2,1H3,(H,25,26)/b14-8- |
| InChIKey | BGQDKMWZLUQFFR-ZSOIEALJSA-N |
| XLogP | 3.38 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.40 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |