C21H24FN3O3 — CID 146427574
4-[(Z)-2-(aminomethyl)-3-fluoroprop-2-enoxy]-N-(4-morpholin-4-ylphenyl)benzamide (PubChem CID 146427574) has the molecular formula C21H24FN3O3 and a molecular weight of 385.44 g/mol. Its IUPAC name is 4-[(Z)-2-(aminomethyl)-3-fluoroprop-2-enoxy]-N-(4-morpholin-4-ylphenyl)benzamide.
| Compound Name | 4-[(Z)-2-(aminomethyl)-3-fluoroprop-2-enoxy]-N-(4-morpholin-4-ylphenyl)benzamide |
|---|---|
| PubChem CID | 146427574 |
| Molecular Formula | C21H24FN3O3 |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | 4-[(Z)-2-(aminomethyl)-3-fluoroprop-2-enoxy]-N-(4-morpholin-4-ylphenyl)benzamide |
| SMILES | NC/C(=C/F)COc1ccc(C(=O)Nc2ccc(N3CCOCC3)cc2)cc1 |
| InChI | InChI=1S/C21H24FN3O3/c22-13-16(14-23)15-28-20-7-1-17(2-8-20)21(26)24-18-3-5-19(6-4-18)25-9-11-27-12-10-25/h1-8,13H,9-12,14-15,23H2,(H,24,26)/b16-13- |
| InChIKey | ZVBXJUTXLIQYQD-SSZFMOIBSA-N |
| XLogP | 2.97 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|