About (2-carbamoylphenyl) hydrogen carbonate
(2-carbamoylphenyl) hydrogen carbonate (PubChem CID 91199327) has the molecular formula C8H7NO4
and a molecular weight of 181.15 g/mol. Its IUPAC name is (2-carbamoylphenyl) hydrogen carbonate.
Molecular Properties
| Compound Name | (2-carbamoylphenyl) hydrogen carbonate |
| PubChem CID | 91199327 |
| Molecular Formula | C8H7NO4 |
| Molecular Weight | 181.15 g/mol |
| Exact Mass | 181.04 |
| IUPAC Name | (2-carbamoylphenyl) hydrogen carbonate |
| SMILES | NC(=O)c1ccccc1OC(=O)O |
| InChI | InChI=1S/C8H7NO4/c9-7(10)5-3-1-2-4-6(5)13-8(11)12/h1-4H,(H2,9,10)(H,11,12) |
| InChIKey | HWUYIPGOQUCFIR-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.15 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze (2-carbamoylphenyl) hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-carbamoylphenyl) hydrogen carbonate?
The IUPAC name of (2-carbamoylphenyl) hydrogen carbonate (CID 91199327) is (2-carbamoylphenyl) hydrogen carbonate.
What is the SMILES notation for (2-carbamoylphenyl) hydrogen carbonate?
The canonical SMILES for (2-carbamoylphenyl) hydrogen carbonate is NC(=O)c1ccccc1OC(=O)O.
What is the InChIKey of (2-carbamoylphenyl) hydrogen carbonate?
The InChIKey is HWUYIPGOQUCFIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NO4/c9-7(10)5-3-1-2-4-6(5)13-8(11)12/h1-4H,(H2,9,10)(H,11,12).
What are the key properties of (2-carbamoylphenyl) hydrogen carbonate?
(2-carbamoylphenyl) hydrogen carbonate has a molecular weight of 181.15 g/mol, XLogP of 0.84, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-carbamoylphenyl) hydrogen carbonate is sourced from PubChem (CID 91199327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).