C9H7Cl2NO2 — CID 141007549
2-(2,2-dichloroethenoxy)benzamide (PubChem CID 141007549) has the molecular formula C9H7Cl2NO2 and a molecular weight of 232.07 g/mol. Its IUPAC name is 2-(2,2-dichloroethenoxy)benzamide.
| Compound Name | 2-(2,2-dichloroethenoxy)benzamide |
|---|---|
| PubChem CID | 141007549 |
| Molecular Formula | C9H7Cl2NO2 |
| Molecular Weight | 232.07 g/mol |
| Exact Mass | 230.99 |
| IUPAC Name | 2-(2,2-dichloroethenoxy)benzamide |
| SMILES | NC(=O)c1ccccc1OC=C(Cl)Cl |
| InChI | InChI=1S/C9H7Cl2NO2/c10-8(11)5-14-7-4-2-1-3-6(7)9(12)13/h1-5H,(H2,12,13) |
| InChIKey | BNCGWWGHENJDFV-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.07 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|