About bis(2-carbamoylphenyl) propanedioate;but-2-ene
bis(2-carbamoylphenyl) propanedioate;but-2-ene (PubChem CID 162215150) has the molecular formula C21H22N2O6
and a molecular weight of 398.42 g/mol. Its IUPAC name is bis(2-carbamoylphenyl) propanedioate;but-2-ene.
Molecular Properties
| Compound Name | bis(2-carbamoylphenyl) propanedioate;but-2-ene |
| PubChem CID | 162215150 |
| Molecular Formula | C21H22N2O6 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | bis(2-carbamoylphenyl) propanedioate;but-2-ene |
| SMILES | CC=CC.NC(=O)c1ccccc1OC(=O)CC(=O)Oc1ccccc1C(N)=O |
| InChI | InChI=1S/C17H14N2O6.C4H8/c18-16(22)10-5-1-3-7-12(10)24-14(20)9-15(21)25-13-8-4-2-6-11(13)17(19)23;1-3-4-2/h1-8H,9H2,(H2,18,22)(H2,19,23);3-4H,1-2H3 |
| InChIKey | ZTJAKMYUAGEJAK-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 138.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze bis(2-carbamoylphenyl) propanedioate;but-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-carbamoylphenyl) propanedioate;but-2-ene?
The IUPAC name of bis(2-carbamoylphenyl) propanedioate;but-2-ene (CID 162215150) is bis(2-carbamoylphenyl) propanedioate;but-2-ene.
What is the SMILES notation for bis(2-carbamoylphenyl) propanedioate;but-2-ene?
The canonical SMILES for bis(2-carbamoylphenyl) propanedioate;but-2-ene is CC=CC.NC(=O)c1ccccc1OC(=O)CC(=O)Oc1ccccc1C(N)=O.
What is the InChIKey of bis(2-carbamoylphenyl) propanedioate;but-2-ene?
The InChIKey is ZTJAKMYUAGEJAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14N2O6.C4H8/c18-16(22)10-5-1-3-7-12(10)24-14(20)9-15(21)25-13-8-4-2-6-11(13)17(19)23;1-3-4-2/h1-8H,9H2,(H2,18,22)(H2,19,23);3-4H,1-2H3.
What are the key properties of bis(2-carbamoylphenyl) propanedioate;but-2-ene?
bis(2-carbamoylphenyl) propanedioate;but-2-ene has a molecular weight of 398.42 g/mol, XLogP of 2.37, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-carbamoylphenyl) propanedioate;but-2-ene is sourced from PubChem (CID 162215150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).