About 2-(2-oxoethoxy)benzamide
2-(2-oxoethoxy)benzamide (PubChem CID 21273663) has the molecular formula C9H9NO3
and a molecular weight of 179.17 g/mol. Its IUPAC name is 2-(2-oxoethoxy)benzamide.
Molecular Properties
| Compound Name | 2-(2-oxoethoxy)benzamide |
| PubChem CID | 21273663 |
| Molecular Formula | C9H9NO3 |
| Molecular Weight | 179.17 g/mol |
| Exact Mass | 179.06 |
| IUPAC Name | 2-(2-oxoethoxy)benzamide |
| SMILES | NC(=O)c1ccccc1OCC=O |
| InChI | InChI=1S/C9H9NO3/c10-9(12)7-3-1-2-4-8(7)13-6-5-11/h1-5H,6H2,(H2,10,12) |
| InChIKey | PGMHVUHRSQDURT-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.17 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-oxoethoxy)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-oxoethoxy)benzamide?
The IUPAC name of 2-(2-oxoethoxy)benzamide (CID 21273663) is 2-(2-oxoethoxy)benzamide.
What is the SMILES notation for 2-(2-oxoethoxy)benzamide?
The canonical SMILES for 2-(2-oxoethoxy)benzamide is NC(=O)c1ccccc1OCC=O.
What is the InChIKey of 2-(2-oxoethoxy)benzamide?
The InChIKey is PGMHVUHRSQDURT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO3/c10-9(12)7-3-1-2-4-8(7)13-6-5-11/h1-5H,6H2,(H2,10,12).
What are the key properties of 2-(2-oxoethoxy)benzamide?
2-(2-oxoethoxy)benzamide has a molecular weight of 179.17 g/mol, XLogP of 0.36, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-oxoethoxy)benzamide is sourced from PubChem (CID 21273663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).