About 2-benzamidooxybenzamide
2-benzamidooxybenzamide (PubChem CID 141083908) has the molecular formula C14H12N2O3
and a molecular weight of 256.26 g/mol. Its IUPAC name is 2-benzamidooxybenzamide.
Molecular Properties
| Compound Name | 2-benzamidooxybenzamide |
| PubChem CID | 141083908 |
| Molecular Formula | C14H12N2O3 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | 2-benzamidooxybenzamide |
| SMILES | NC(=O)c1ccccc1ONC(=O)c1ccccc1 |
| InChI | InChI=1S/C14H12N2O3/c15-13(17)11-8-4-5-9-12(11)19-16-14(18)10-6-2-1-3-7-10/h1-9H,(H2,15,17)(H,16,18) |
| InChIKey | YAPKDFBCBUCHLN-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-benzamidooxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzamidooxybenzamide?
The IUPAC name of 2-benzamidooxybenzamide (CID 141083908) is 2-benzamidooxybenzamide.
What is the SMILES notation for 2-benzamidooxybenzamide?
The canonical SMILES for 2-benzamidooxybenzamide is NC(=O)c1ccccc1ONC(=O)c1ccccc1.
What is the InChIKey of 2-benzamidooxybenzamide?
The InChIKey is YAPKDFBCBUCHLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N2O3/c15-13(17)11-8-4-5-9-12(11)19-16-14(18)10-6-2-1-3-7-10/h1-9H,(H2,15,17)(H,16,18).
What are the key properties of 2-benzamidooxybenzamide?
2-benzamidooxybenzamide has a molecular weight of 256.26 g/mol, XLogP of 1.51, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzamidooxybenzamide is sourced from PubChem (CID 141083908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).