C25H26N2O2 — CID 4568499
[1-(4-cyclohexylphenyl)ethylideneamino] N-naphthalen-1-ylcarbamate (PubChem CID 4568499) has the molecular formula C25H26N2O2 and a molecular weight of 386.50 g/mol. Its IUPAC name is [1-(4-cyclohexylphenyl)ethylideneamino] N-naphthalen-1-ylcarbamate.
| Compound Name | [1-(4-cyclohexylphenyl)ethylideneamino] N-naphthalen-1-ylcarbamate |
|---|---|
| PubChem CID | 4568499 |
| Molecular Formula | C25H26N2O2 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | [1-(4-cyclohexylphenyl)ethylideneamino] N-naphthalen-1-ylcarbamate |
| SMILES | CC(=NOC(=O)Nc1cccc2ccccc12)c1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C25H26N2O2/c1-18(19-14-16-21(17-15-19)20-8-3-2-4-9-20)27-29-25(28)26-24-13-7-11-22-10-5-6-12-23(22)24/h5-7,10-17,20H,2-4,8-9H2,1H3,(H,26,28) |
| InChIKey | PMPBDPHVBHLCIJ-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|