C36H42N4O2 — CID 6256670
1-N,4-N-bis[(Z)-1-(4-cyclohexylphenyl)ethylideneamino]benzene-1,4-dicarboxamide (PubChem CID 6256670) has the molecular formula C36H42N4O2 and a molecular weight of 562.76 g/mol. Its IUPAC name is 1-N,4-N-bis[(Z)-1-(4-cyclohexylphenyl)ethylideneamino]benzene-1,4-dicarboxamide.
| Compound Name | 1-N,4-N-bis[(Z)-1-(4-cyclohexylphenyl)ethylideneamino]benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 6256670 |
| Molecular Formula | C36H42N4O2 |
| Molecular Weight | 562.76 g/mol |
| Exact Mass | 562.33 |
| IUPAC Name | 1-N,4-N-bis[(Z)-1-(4-cyclohexylphenyl)ethylideneamino]benzene-1,4-dicarboxamide |
| SMILES | C/C(=N/NC(=O)c1ccc(C(=O)N/N=C(/C)c2ccc(C3CCCCC3)cc2)cc1)c1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C36H42N4O2/c1-25(27-13-17-31(18-14-27)29-9-5-3-6-10-29)37-39-35(41)33-21-23-34(24-22-33)36(42)40-38-26(2)28-15-19-32(20-16-28)30-11-7-4-8-12-30/h13-24,29-30H,3-12H2,1-2H3,(H,39,41)(H,40,42)/b37-25-,38-26- |
| InChIKey | USAUIDNOGGADIG-MEDPLMNLSA-N |
| XLogP | 8.09 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.76 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|