C22H26N2O — CID 4581588
N-[1-(4-cyclohexylphenyl)ethylideneamino]-4-methylbenzamide (PubChem CID 4581588) has the molecular formula C22H26N2O and a molecular weight of 334.46 g/mol. Its IUPAC name is N-[1-(4-cyclohexylphenyl)ethylideneamino]-4-methylbenzamide.
| Compound Name | N-[1-(4-cyclohexylphenyl)ethylideneamino]-4-methylbenzamide |
|---|---|
| PubChem CID | 4581588 |
| Molecular Formula | C22H26N2O |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | N-[1-(4-cyclohexylphenyl)ethylideneamino]-4-methylbenzamide |
| SMILES | CC(=NNC(=O)c1ccc(C)cc1)c1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C22H26N2O/c1-16-8-10-21(11-9-16)22(25)24-23-17(2)18-12-14-20(15-13-18)19-6-4-3-5-7-19/h8-15,19H,3-7H2,1-2H3,(H,24,25) |
| InChIKey | XARHTJZTACDOKI-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|