About 4-cyclohexyl-N'-methylbenzohydrazide
4-cyclohexyl-N'-methylbenzohydrazide (PubChem CID 116846851) has the molecular formula C14H20N2O
and a molecular weight of 232.33 g/mol. Its IUPAC name is 4-cyclohexyl-N'-methylbenzohydrazide.
Molecular Properties
| Compound Name | 4-cyclohexyl-N'-methylbenzohydrazide |
| PubChem CID | 116846851 |
| Molecular Formula | C14H20N2O |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | 4-cyclohexyl-N'-methylbenzohydrazide |
| SMILES | CNNC(=O)c1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C14H20N2O/c1-15-16-14(17)13-9-7-12(8-10-13)11-5-3-2-4-6-11/h7-11,15H,2-6H2,1H3,(H,16,17) |
| InChIKey | CMZREZHHWZEWTD-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-cyclohexyl-N'-methylbenzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclohexyl-N'-methylbenzohydrazide?
The IUPAC name of 4-cyclohexyl-N'-methylbenzohydrazide (CID 116846851) is 4-cyclohexyl-N'-methylbenzohydrazide.
What is the SMILES notation for 4-cyclohexyl-N'-methylbenzohydrazide?
The canonical SMILES for 4-cyclohexyl-N'-methylbenzohydrazide is CNNC(=O)c1ccc(C2CCCCC2)cc1.
What is the InChIKey of 4-cyclohexyl-N'-methylbenzohydrazide?
The InChIKey is CMZREZHHWZEWTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N2O/c1-15-16-14(17)13-9-7-12(8-10-13)11-5-3-2-4-6-11/h7-11,15H,2-6H2,1H3,(H,16,17).
What are the key properties of 4-cyclohexyl-N'-methylbenzohydrazide?
4-cyclohexyl-N'-methylbenzohydrazide has a molecular weight of 232.33 g/mol, XLogP of 2.60, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclohexyl-N'-methylbenzohydrazide is sourced from PubChem (CID 116846851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).