C19H22N2OS — CID 3638697
N-[1-(4-cyclohexylphenyl)ethylideneamino]thiophene-2-carboxamide (PubChem CID 3638697) has the molecular formula C19H22N2OS and a molecular weight of 326.47 g/mol. Its IUPAC name is N-[1-(4-cyclohexylphenyl)ethylideneamino]thiophene-2-carboxamide.
| Compound Name | N-[1-(4-cyclohexylphenyl)ethylideneamino]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 3638697 |
| Molecular Formula | C19H22N2OS |
| Molecular Weight | 326.47 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | N-[1-(4-cyclohexylphenyl)ethylideneamino]thiophene-2-carboxamide |
| SMILES | CC(=NNC(=O)c1cccs1)c1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C19H22N2OS/c1-14(20-21-19(22)18-8-5-13-23-18)15-9-11-17(12-10-15)16-6-3-2-4-7-16/h5,8-13,16H,2-4,6-7H2,1H3,(H,21,22) |
| InChIKey | NSAKFUGWHGJGOM-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.47 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|