C21H24N2O2 — CID 3435837
4-[2-[1-(4-cyclohexylphenyl)ethylidene]hydrazinyl]benzoic acid (PubChem CID 3435837) has the molecular formula C21H24N2O2 and a molecular weight of 336.44 g/mol. Its IUPAC name is 4-[2-[1-(4-cyclohexylphenyl)ethylidene]hydrazinyl]benzoic acid.
| Compound Name | 4-[2-[1-(4-cyclohexylphenyl)ethylidene]hydrazinyl]benzoic acid |
|---|---|
| PubChem CID | 3435837 |
| Molecular Formula | C21H24N2O2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | 4-[2-[1-(4-cyclohexylphenyl)ethylidene]hydrazinyl]benzoic acid |
| SMILES | CC(=NNc1ccc(C(=O)O)cc1)c1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C21H24N2O2/c1-15(22-23-20-13-11-19(12-14-20)21(24)25)16-7-9-18(10-8-16)17-5-3-2-4-6-17/h7-14,17,23H,2-6H2,1H3,(H,24,25) |
| InChIKey | LPCVPJOLWGARSZ-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|