C15H17NO5 — CID 67868291
1,3,4-trihydroxybutan-2-yl N-naphthalen-1-ylcarbamate (PubChem CID 67868291) has the molecular formula C15H17NO5 and a molecular weight of 291.30 g/mol. Its IUPAC name is 1,3,4-trihydroxybutan-2-yl N-naphthalen-1-ylcarbamate.
| Compound Name | 1,3,4-trihydroxybutan-2-yl N-naphthalen-1-ylcarbamate |
|---|---|
| PubChem CID | 67868291 |
| Molecular Formula | C15H17NO5 |
| Molecular Weight | 291.30 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 1,3,4-trihydroxybutan-2-yl N-naphthalen-1-ylcarbamate |
| SMILES | O=C(Nc1cccc2ccccc12)OC(CO)C(O)CO |
| InChI | InChI=1S/C15H17NO5/c17-8-13(19)14(9-18)21-15(20)16-12-7-3-5-10-4-1-2-6-11(10)12/h1-7,13-14,17-19H,8-9H2,(H,16,20) |
| InChIKey | SPDWFRLBPCTAEA-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.30 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |