C17H19NO5 — CID 86144137
1,3,4,5-tetrahydroxy-N-naphthalen-1-ylcyclohexane-1-carboxamide (PubChem CID 86144137) has the molecular formula C17H19NO5 and a molecular weight of 317.34 g/mol. Its IUPAC name is 1,3,4,5-tetrahydroxy-N-naphthalen-1-ylcyclohexane-1-carboxamide.
| Compound Name | 1,3,4,5-tetrahydroxy-N-naphthalen-1-ylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 86144137 |
| Molecular Formula | C17H19NO5 |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | 1,3,4,5-tetrahydroxy-N-naphthalen-1-ylcyclohexane-1-carboxamide |
| SMILES | O=C(Nc1cccc2ccccc12)C1(O)CC(O)C(O)C(O)C1 |
| InChI | InChI=1S/C17H19NO5/c19-13-8-17(23,9-14(20)15(13)21)16(22)18-12-7-3-5-10-4-1-2-6-11(10)12/h1-7,13-15,19-21,23H,8-9H2,(H,18,22) |
| InChIKey | YLTNZNIYECQUNM-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 110.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |