C21H18N2O3 — CID 142413600
1-N-(4-hydroxyphenyl)-1-N'-naphthalen-1-ylcyclopropane-1,1-dicarboxamide (PubChem CID 142413600) has the molecular formula C21H18N2O3 and a molecular weight of 346.39 g/mol. Its IUPAC name is 1-N-(4-hydroxyphenyl)-1-N'-naphthalen-1-ylcyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N-(4-hydroxyphenyl)-1-N'-naphthalen-1-ylcyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 142413600 |
| Molecular Formula | C21H18N2O3 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | 1-N-(4-hydroxyphenyl)-1-N'-naphthalen-1-ylcyclopropane-1,1-dicarboxamide |
| SMILES | O=C(Nc1ccc(O)cc1)C1(C(=O)Nc2cccc3ccccc23)CC1 |
| InChI | InChI=1S/C21H18N2O3/c24-16-10-8-15(9-11-16)22-19(25)21(12-13-21)20(26)23-18-7-3-5-14-4-1-2-6-17(14)18/h1-11,24H,12-13H2,(H,22,25)(H,23,26) |
| InChIKey | LYNIOVADNNWUCB-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|