About (naphthalen-1-ylamino) propanoate
(naphthalen-1-ylamino) propanoate (PubChem CID 174368377) has the molecular formula C13H13NO2
and a molecular weight of 215.25 g/mol. Its IUPAC name is (naphthalen-1-ylamino) propanoate.
Molecular Properties
| Compound Name | (naphthalen-1-ylamino) propanoate |
| PubChem CID | 174368377 |
| Molecular Formula | C13H13NO2 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.09 |
| IUPAC Name | (naphthalen-1-ylamino) propanoate |
| SMILES | CCC(=O)ONc1cccc2ccccc12 |
| InChI | InChI=1S/C13H13NO2/c1-2-13(15)16-14-12-9-5-7-10-6-3-4-8-11(10)12/h3-9,14H,2H2,1H3 |
| InChIKey | DPFKFYAWVXPXLD-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (naphthalen-1-ylamino) propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (naphthalen-1-ylamino) propanoate?
The IUPAC name of (naphthalen-1-ylamino) propanoate (CID 174368377) is (naphthalen-1-ylamino) propanoate.
What is the SMILES notation for (naphthalen-1-ylamino) propanoate?
The canonical SMILES for (naphthalen-1-ylamino) propanoate is CCC(=O)ONc1cccc2ccccc12.
What is the InChIKey of (naphthalen-1-ylamino) propanoate?
The InChIKey is DPFKFYAWVXPXLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NO2/c1-2-13(15)16-14-12-9-5-7-10-6-3-4-8-11(10)12/h3-9,14H,2H2,1H3.
What are the key properties of (naphthalen-1-ylamino) propanoate?
(naphthalen-1-ylamino) propanoate has a molecular weight of 215.25 g/mol, XLogP of 3.12, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (naphthalen-1-ylamino) propanoate is sourced from PubChem (CID 174368377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).