About (2-methylanilino) hexanoate
(2-methylanilino) hexanoate (PubChem CID 174905248) has the molecular formula C13H19NO2
and a molecular weight of 221.30 g/mol. Its IUPAC name is (2-methylanilino) hexanoate.
Molecular Properties
| Compound Name | (2-methylanilino) hexanoate |
| PubChem CID | 174905248 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | (2-methylanilino) hexanoate |
| SMILES | CCCCCC(=O)ONc1ccccc1C |
| InChI | InChI=1S/C13H19NO2/c1-3-4-5-10-13(15)16-14-12-9-7-6-8-11(12)2/h6-9,14H,3-5,10H2,1-2H3 |
| InChIKey | ZCEDUHFTZWESGI-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2-methylanilino) hexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methylanilino) hexanoate?
The IUPAC name of (2-methylanilino) hexanoate (CID 174905248) is (2-methylanilino) hexanoate.
What is the SMILES notation for (2-methylanilino) hexanoate?
The canonical SMILES for (2-methylanilino) hexanoate is CCCCCC(=O)ONc1ccccc1C.
What is the InChIKey of (2-methylanilino) hexanoate?
The InChIKey is ZCEDUHFTZWESGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO2/c1-3-4-5-10-13(15)16-14-12-9-7-6-8-11(12)2/h6-9,14H,3-5,10H2,1-2H3.
What are the key properties of (2-methylanilino) hexanoate?
(2-methylanilino) hexanoate has a molecular weight of 221.30 g/mol, XLogP of 3.45, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methylanilino) hexanoate is sourced from PubChem (CID 174905248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).