C20H23ClN2O2S — CID 8789170
3-(3-chloro-4-methylphenyl)-1-[[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]-1-propylthiourea (PubChem CID 8789170) has the molecular formula C20H23ClN2O2S and a molecular weight of 390.94 g/mol. Its IUPAC name is 3-(3-chloro-4-methylphenyl)-1-[[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]-1-propylthiourea.
| Compound Name | 3-(3-chloro-4-methylphenyl)-1-[[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]-1-propylthiourea |
|---|---|
| PubChem CID | 8789170 |
| Molecular Formula | C20H23ClN2O2S |
| Molecular Weight | 390.94 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | 3-(3-chloro-4-methylphenyl)-1-[[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]-1-propylthiourea |
| SMILES | CCCN(C[C@H]1COc2ccccc2O1)C(=S)Nc1ccc(C)c(Cl)c1 |
| InChI | InChI=1S/C20H23ClN2O2S/c1-3-10-23(20(26)22-15-9-8-14(2)17(21)11-15)12-16-13-24-18-6-4-5-7-19(18)25-16/h4-9,11,16H,3,10,12-13H2,1-2H3,(H,22,26)/t16-/m0/s1 |
| InChIKey | PSWUUKMNRBOOOD-INIZCTEOSA-N |
| XLogP | 4.90 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.94 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|