C19H20F2N2O2S2 — CID 8682979
3-[4-(difluoromethylsulfanyl)phenyl]-1-[[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]-1-ethylthiourea (PubChem CID 8682979) has the molecular formula C19H20F2N2O2S2 and a molecular weight of 410.51 g/mol. Its IUPAC name is 3-[4-(difluoromethylsulfanyl)phenyl]-1-[[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]-1-ethylthiourea.
| Compound Name | 3-[4-(difluoromethylsulfanyl)phenyl]-1-[[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]-1-ethylthiourea |
|---|---|
| PubChem CID | 8682979 |
| Molecular Formula | C19H20F2N2O2S2 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | 3-[4-(difluoromethylsulfanyl)phenyl]-1-[[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]-1-ethylthiourea |
| SMILES | CCN(C[C@H]1COc2ccccc2O1)C(=S)Nc1ccc(SC(F)F)cc1 |
| InChI | InChI=1S/C19H20F2N2O2S2/c1-2-23(11-14-12-24-16-5-3-4-6-17(16)25-14)19(26)22-13-7-9-15(10-8-13)27-18(20)21/h3-10,14,18H,2,11-12H2,1H3,(H,22,26)/t14-/m0/s1 |
| InChIKey | IMJPFPCLPCWHNZ-AWEZNQCLSA-N |
| XLogP | 4.86 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|