C15H20N2S — CID 19653074
3-(3,4-dimethylphenyl)-1,1-bis(prop-2-enyl)thiourea (PubChem CID 19653074) has the molecular formula C15H20N2S and a molecular weight of 260.41 g/mol. Its IUPAC name is 3-(3,4-dimethylphenyl)-1,1-bis(prop-2-enyl)thiourea.
| Compound Name | 3-(3,4-dimethylphenyl)-1,1-bis(prop-2-enyl)thiourea |
|---|---|
| PubChem CID | 19653074 |
| Molecular Formula | C15H20N2S |
| Molecular Weight | 260.41 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 3-(3,4-dimethylphenyl)-1,1-bis(prop-2-enyl)thiourea |
| SMILES | C=CCN(CC=C)C(=S)Nc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C15H20N2S/c1-5-9-17(10-6-2)15(18)16-14-8-7-12(3)13(4)11-14/h5-8,11H,1-2,9-10H2,3-4H3,(H,16,18) |
| InChIKey | UKGHFXRRMARAMP-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.41 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|