C18H22N2S2 — CID 8682917
3-(3,4-dimethylphenyl)-1-methyl-1-[(4-methylsulfanylphenyl)methyl]thiourea (PubChem CID 8682917) has the molecular formula C18H22N2S2 and a molecular weight of 330.52 g/mol. Its IUPAC name is 3-(3,4-dimethylphenyl)-1-methyl-1-[(4-methylsulfanylphenyl)methyl]thiourea.
| Compound Name | 3-(3,4-dimethylphenyl)-1-methyl-1-[(4-methylsulfanylphenyl)methyl]thiourea |
|---|---|
| PubChem CID | 8682917 |
| Molecular Formula | C18H22N2S2 |
| Molecular Weight | 330.52 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | 3-(3,4-dimethylphenyl)-1-methyl-1-[(4-methylsulfanylphenyl)methyl]thiourea |
| SMILES | CSc1ccc(CN(C)C(=S)Nc2ccc(C)c(C)c2)cc1 |
| InChI | InChI=1S/C18H22N2S2/c1-13-5-8-16(11-14(13)2)19-18(21)20(3)12-15-6-9-17(22-4)10-7-15/h5-11H,12H2,1-4H3,(H,19,21) |
| InChIKey | NIIVNTCOIJPNTK-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.52 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|