C16H17FN2S2 — CID 8787196
3-(2-fluorophenyl)-1-methyl-1-[(4-methylsulfanylphenyl)methyl]thiourea (PubChem CID 8787196) has the molecular formula C16H17FN2S2 and a molecular weight of 320.46 g/mol. Its IUPAC name is 3-(2-fluorophenyl)-1-methyl-1-[(4-methylsulfanylphenyl)methyl]thiourea.
| Compound Name | 3-(2-fluorophenyl)-1-methyl-1-[(4-methylsulfanylphenyl)methyl]thiourea |
|---|---|
| PubChem CID | 8787196 |
| Molecular Formula | C16H17FN2S2 |
| Molecular Weight | 320.46 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | 3-(2-fluorophenyl)-1-methyl-1-[(4-methylsulfanylphenyl)methyl]thiourea |
| SMILES | CSc1ccc(CN(C)C(=S)Nc2ccccc2F)cc1 |
| InChI | InChI=1S/C16H17FN2S2/c1-19(11-12-7-9-13(21-2)10-8-12)16(20)18-15-6-4-3-5-14(15)17/h3-10H,11H2,1-2H3,(H,18,20) |
| InChIKey | CCIHHHHSLPZORP-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.46 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|