C17H19ClN2S2 — CID 8787206
3-(3-chloro-4-methylphenyl)-1-methyl-1-[(4-methylsulfanylphenyl)methyl]thiourea (PubChem CID 8787206) has the molecular formula C17H19ClN2S2 and a molecular weight of 350.94 g/mol. Its IUPAC name is 3-(3-chloro-4-methylphenyl)-1-methyl-1-[(4-methylsulfanylphenyl)methyl]thiourea.
| Compound Name | 3-(3-chloro-4-methylphenyl)-1-methyl-1-[(4-methylsulfanylphenyl)methyl]thiourea |
|---|---|
| PubChem CID | 8787206 |
| Molecular Formula | C17H19ClN2S2 |
| Molecular Weight | 350.94 g/mol |
| Exact Mass | 350.07 |
| IUPAC Name | 3-(3-chloro-4-methylphenyl)-1-methyl-1-[(4-methylsulfanylphenyl)methyl]thiourea |
| SMILES | CSc1ccc(CN(C)C(=S)Nc2ccc(C)c(Cl)c2)cc1 |
| InChI | InChI=1S/C17H19ClN2S2/c1-12-4-7-14(10-16(12)18)19-17(21)20(2)11-13-5-8-15(22-3)9-6-13/h4-10H,11H2,1-3H3,(H,19,21) |
| InChIKey | UKXAFBARDCPJLG-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.94 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|