C21H20ClN3S — CID 2471013
1-(N-benzylanilino)-3-(3-chloro-4-methylphenyl)thiourea (PubChem CID 2471013) has the molecular formula C21H20ClN3S and a molecular weight of 381.93 g/mol. Its IUPAC name is 1-(N-benzylanilino)-3-(3-chloro-4-methylphenyl)thiourea.
| Compound Name | 1-(N-benzylanilino)-3-(3-chloro-4-methylphenyl)thiourea |
|---|---|
| PubChem CID | 2471013 |
| Molecular Formula | C21H20ClN3S |
| Molecular Weight | 381.93 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | 1-(N-benzylanilino)-3-(3-chloro-4-methylphenyl)thiourea |
| SMILES | Cc1ccc(NC(=S)NN(Cc2ccccc2)c2ccccc2)cc1Cl |
| InChI | InChI=1S/C21H20ClN3S/c1-16-12-13-18(14-20(16)22)23-21(26)24-25(19-10-6-3-7-11-19)15-17-8-4-2-5-9-17/h2-14H,15H2,1H3,(H2,23,24,26) |
| InChIKey | MSDLXHHHDRLVNL-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.93 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|