C17H18Cl2N2S — CID 8683450
1-[(3,4-dichlorophenyl)methyl]-3-(2,5-dimethylphenyl)-1-methylthiourea (PubChem CID 8683450) has the molecular formula C17H18Cl2N2S and a molecular weight of 353.32 g/mol. Its IUPAC name is 1-[(3,4-dichlorophenyl)methyl]-3-(2,5-dimethylphenyl)-1-methylthiourea.
| Compound Name | 1-[(3,4-dichlorophenyl)methyl]-3-(2,5-dimethylphenyl)-1-methylthiourea |
|---|---|
| PubChem CID | 8683450 |
| Molecular Formula | C17H18Cl2N2S |
| Molecular Weight | 353.32 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | 1-[(3,4-dichlorophenyl)methyl]-3-(2,5-dimethylphenyl)-1-methylthiourea |
| SMILES | Cc1ccc(C)c(NC(=S)N(C)Cc2ccc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C17H18Cl2N2S/c1-11-4-5-12(2)16(8-11)20-17(22)21(3)10-13-6-7-14(18)15(19)9-13/h4-9H,10H2,1-3H3,(H,20,22) |
| InChIKey | OZPXDVRDUFCBIE-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.32 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|