C13H20Cl2N3S+ — CID 8788124
2-[[(3,4-dichlorophenyl)methyl-methylcarbamothioyl]amino]ethyl-dimethylazanium (PubChem CID 8788124) has the molecular formula C13H20Cl2N3S+ and a molecular weight of 321.30 g/mol. Its IUPAC name is 2-[[(3,4-dichlorophenyl)methyl-methylcarbamothioyl]amino]ethyl-dimethylazanium.
| Compound Name | 2-[[(3,4-dichlorophenyl)methyl-methylcarbamothioyl]amino]ethyl-dimethylazanium |
|---|---|
| PubChem CID | 8788124 |
| Molecular Formula | C13H20Cl2N3S+ |
| Molecular Weight | 321.30 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | 2-[[(3,4-dichlorophenyl)methyl-methylcarbamothioyl]amino]ethyl-dimethylazanium |
| SMILES | CN(Cc1ccc(Cl)c(Cl)c1)C(=S)NCC[NH+](C)C |
| InChI | InChI=1S/C13H19Cl2N3S/c1-17(2)7-6-16-13(19)18(3)9-10-4-5-11(14)12(15)8-10/h4-5,8H,6-7,9H2,1-3H3,(H,16,19)/p+1 |
| InChIKey | DPVOLNMYTGKWDP-UHFFFAOYSA-O |
| XLogP | 1.44 |
| TPSA | 19.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.30 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|