C9H11Cl2N2S+ — CID 137163213
[(3,4-dichlorophenyl)methyl-methylcarbamothioyl]azanium (PubChem CID 137163213) has the molecular formula C9H11Cl2N2S+ and a molecular weight of 250.17 g/mol. Its IUPAC name is [(3,4-dichlorophenyl)methyl-methylcarbamothioyl]azanium.
| Compound Name | [(3,4-dichlorophenyl)methyl-methylcarbamothioyl]azanium |
|---|---|
| PubChem CID | 137163213 |
| Molecular Formula | C9H11Cl2N2S+ |
| Molecular Weight | 250.17 g/mol |
| Exact Mass | 249.00 |
| IUPAC Name | [(3,4-dichlorophenyl)methyl-methylcarbamothioyl]azanium |
| SMILES | CN(Cc1ccc(Cl)c(Cl)c1)C([NH3+])=S |
| InChI | InChI=1S/C9H10Cl2N2S/c1-13(9(12)14)5-6-2-3-7(10)8(11)4-6/h2-4H,5H2,1H3,(H2,12,14)/p+1 |
| InChIKey | WZIRYBOHKPKKKK-UHFFFAOYSA-O |
| XLogP | 1.95 |
| TPSA | 30.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.17 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|