C16H21BrN4S — CID 19456149
1-[(4-bromo-1-ethylpyrazol-3-yl)methyl]-3-(2,5-dimethylphenyl)-1-methylthiourea (PubChem CID 19456149) has the molecular formula C16H21BrN4S and a molecular weight of 381.34 g/mol. Its IUPAC name is 1-[(4-bromo-1-ethylpyrazol-3-yl)methyl]-3-(2,5-dimethylphenyl)-1-methylthiourea.
| Compound Name | 1-[(4-bromo-1-ethylpyrazol-3-yl)methyl]-3-(2,5-dimethylphenyl)-1-methylthiourea |
|---|---|
| PubChem CID | 19456149 |
| Molecular Formula | C16H21BrN4S |
| Molecular Weight | 381.34 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | 1-[(4-bromo-1-ethylpyrazol-3-yl)methyl]-3-(2,5-dimethylphenyl)-1-methylthiourea |
| SMILES | CCn1cc(Br)c(CN(C)C(=S)Nc2cc(C)ccc2C)n1 |
| InChI | InChI=1S/C16H21BrN4S/c1-5-21-9-13(17)15(19-21)10-20(4)16(22)18-14-8-11(2)6-7-12(14)3/h6-9H,5,10H2,1-4H3,(H,18,22) |
| InChIKey | KFELPGSNTQSYNC-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.34 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|