C12H21BrN4S — CID 19456138
1-[(4-bromo-1-ethylpyrazol-3-yl)methyl]-1-methyl-3-(2-methylpropyl)thiourea (PubChem CID 19456138) has the molecular formula C12H21BrN4S and a molecular weight of 333.30 g/mol. Its IUPAC name is 1-[(4-bromo-1-ethylpyrazol-3-yl)methyl]-1-methyl-3-(2-methylpropyl)thiourea.
| Compound Name | 1-[(4-bromo-1-ethylpyrazol-3-yl)methyl]-1-methyl-3-(2-methylpropyl)thiourea |
|---|---|
| PubChem CID | 19456138 |
| Molecular Formula | C12H21BrN4S |
| Molecular Weight | 333.30 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | 1-[(4-bromo-1-ethylpyrazol-3-yl)methyl]-1-methyl-3-(2-methylpropyl)thiourea |
| SMILES | CCn1cc(Br)c(CN(C)C(=S)NCC(C)C)n1 |
| InChI | InChI=1S/C12H21BrN4S/c1-5-17-7-10(13)11(15-17)8-16(4)12(18)14-6-9(2)3/h7,9H,5-6,8H2,1-4H3,(H,14,18) |
| InChIKey | PFHVLKMBBFVGJG-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.30 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|